CH4K2O6S2 — CID 131856458
CID 131856458 (PubChem CID 131856458) has the molecular formula CH4K2O6S2 and a molecular weight of 254.37 g/mol.
| Compound Name | CID 131856458 |
|---|---|
| PubChem CID | 131856458 |
| Molecular Formula | CH4K2O6S2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 253.87 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)CS(=O)(=O)O.[K].[K] |
| InChI | InChI=1S/CH4O6S2.2K/c2-8(3,4)1-9(5,6)7;;/h1H2,(H,2,3,4)(H,5,6,7);; |
| InChIKey | KMMDYMXRRJICJN-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|