C33H32N8O4 — CID 175555581
3-[4-[[6-[[[3-(6-hydroxy-3-oxo-1,2-dihydroisoindol-1-yl)-1H-indol-2-yl]methylamino]methyl]indol-1-yl]methyl]triazol-1-yl]propyl carbamate (PubChem CID 175555581) has the molecular formula C33H32N8O4 and a molecular weight of 604.67 g/mol. Its IUPAC name is 3-[4-[[6-[[[3-(6-hydroxy-3-oxo-1,2-dihydroisoindol-1-yl)-1H-indol-2-yl]methylamino]methyl]indol-1-yl]methyl]triazol-1-yl]propyl carbamate.
| Compound Name | 3-[4-[[6-[[[3-(6-hydroxy-3-oxo-1,2-dihydroisoindol-1-yl)-1H-indol-2-yl]methylamino]methyl]indol-1-yl]methyl]triazol-1-yl]propyl carbamate |
|---|---|
| PubChem CID | 175555581 |
| Molecular Formula | C33H32N8O4 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 3-[4-[[6-[[[3-(6-hydroxy-3-oxo-1,2-dihydroisoindol-1-yl)-1H-indol-2-yl]methylamino]methyl]indol-1-yl]methyl]triazol-1-yl]propyl carbamate |
| SMILES | NC(=O)OCCCn1cc(Cn2ccc3ccc(CNCc4[nH]c5ccccc5c4C4NC(=O)c5ccc(O)cc54)cc32)nn1 |
| InChI | InChI=1S/C33H32N8O4/c34-33(44)45-13-3-11-41-19-22(38-39-41)18-40-12-10-21-7-6-20(14-29(21)40)16-35-17-28-30(25-4-1-2-5-27(25)36-28)31-26-15-23(42)8-9-24(26)32(43)37-31/h1-2,4-10,12,14-15,19,31,35-36,42H,3,11,13,16-18H2,(H2,34,44)(H,37,43) |
| InChIKey | DERLUEIKCNHXRG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 165.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|