About prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene
prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene (PubChem CID 175558355) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene.
Molecular Properties
| Compound Name | prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene |
| PubChem CID | 175558355 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene |
| SMILES | C=CCN.C=CCS(=O)CC=C |
| InChI | InChI=1S/C6H10OS.C3H7N/c1-3-5-8(7)6-4-2;1-2-3-4/h3-4H,1-2,5-6H2;2H,1,3-4H2 |
| InChIKey | QHUUGYFSOARWQN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene?
The IUPAC name of prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene (CID 175558355) is prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene.
What is the SMILES notation for prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene?
The canonical SMILES for prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene is C=CCN.C=CCS(=O)CC=C.
What is the InChIKey of prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene?
The InChIKey is QHUUGYFSOARWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS.C3H7N/c1-3-5-8(7)6-4-2;1-2-3-4/h3-4H,1-2,5-6H2;2H,1,3-4H2.
What are the key properties of prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene?
prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene has a molecular weight of 187.31 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-en-1-amine;3-prop-2-enylsulfinylprop-1-ene is sourced from PubChem (CID 175558355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).