About acetic acid;1-ethylpyridin-1-ium;formic acid
acetic acid;1-ethylpyridin-1-ium;formic acid (PubChem CID 175559177) has the molecular formula C10H16NO4+
and a molecular weight of 214.24 g/mol. Its IUPAC name is acetic acid;1-ethylpyridin-1-ium;formic acid.
Molecular Properties
| Compound Name | acetic acid;1-ethylpyridin-1-ium;formic acid |
| PubChem CID | 175559177 |
| Molecular Formula | C10H16NO4+ |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | acetic acid;1-ethylpyridin-1-ium;formic acid |
| SMILES | CC(=O)O.CC[n+]1ccccc1.O=CO |
| InChI | InChI=1S/C7H10N.C2H4O2.CH2O2/c1-2-8-6-4-3-5-7-8;1-2(3)4;2-1-3/h3-7H,2H2,1H3;1H3,(H,3,4);1H,(H,2,3)/q+1;; |
| InChIKey | UEZJMVLHXQKWBE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-ethylpyridin-1-ium;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-ethylpyridin-1-ium;formic acid?
The IUPAC name of acetic acid;1-ethylpyridin-1-ium;formic acid (CID 175559177) is acetic acid;1-ethylpyridin-1-ium;formic acid.
What is the SMILES notation for acetic acid;1-ethylpyridin-1-ium;formic acid?
The canonical SMILES for acetic acid;1-ethylpyridin-1-ium;formic acid is CC(=O)O.CC[n+]1ccccc1.O=CO.
What is the InChIKey of acetic acid;1-ethylpyridin-1-ium;formic acid?
The InChIKey is UEZJMVLHXQKWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N.C2H4O2.CH2O2/c1-2-8-6-4-3-5-7-8;1-2(3)4;2-1-3/h3-7H,2H2,1H3;1H3,(H,3,4);1H,(H,2,3)/q+1;;.
What are the key properties of acetic acid;1-ethylpyridin-1-ium;formic acid?
acetic acid;1-ethylpyridin-1-ium;formic acid has a molecular weight of 214.24 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethylpyridin-1-ium;formic acid is sourced from PubChem (CID 175559177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).