About 1-ethylpyridin-1-ium;1-methylpyridin-1-ium
1-ethylpyridin-1-ium;1-methylpyridin-1-ium (PubChem CID 160508395) has the molecular formula C13H18N2+2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-ethylpyridin-1-ium;1-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-ethylpyridin-1-ium;1-methylpyridin-1-ium |
| PubChem CID | 160508395 |
| Molecular Formula | C13H18N2+2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-ethylpyridin-1-ium;1-methylpyridin-1-ium |
| SMILES | CC[n+]1ccccc1.C[n+]1ccccc1 |
| InChI | InChI=1S/C7H10N.C6H8N/c1-2-8-6-4-3-5-7-8;1-7-5-3-2-4-6-7/h3-7H,2H2,1H3;2-6H,1H3/q2*+1 |
| InChIKey | QSSJVFNIJSASRA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyridin-1-ium;1-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridin-1-ium;1-methylpyridin-1-ium?
The IUPAC name of 1-ethylpyridin-1-ium;1-methylpyridin-1-ium (CID 160508395) is 1-ethylpyridin-1-ium;1-methylpyridin-1-ium.
What is the SMILES notation for 1-ethylpyridin-1-ium;1-methylpyridin-1-ium?
The canonical SMILES for 1-ethylpyridin-1-ium;1-methylpyridin-1-ium is CC[n+]1ccccc1.C[n+]1ccccc1.
What is the InChIKey of 1-ethylpyridin-1-ium;1-methylpyridin-1-ium?
The InChIKey is QSSJVFNIJSASRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N.C6H8N/c1-2-8-6-4-3-5-7-8;1-7-5-3-2-4-6-7/h3-7H,2H2,1H3;2-6H,1H3/q2*+1.
What are the key properties of 1-ethylpyridin-1-ium;1-methylpyridin-1-ium?
1-ethylpyridin-1-ium;1-methylpyridin-1-ium has a molecular weight of 202.30 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridin-1-ium;1-methylpyridin-1-ium is sourced from PubChem (CID 160508395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).