About 1-methylpyridin-1-ium;tetraiodoplumbane;iodide
1-methylpyridin-1-ium;tetraiodoplumbane;iodide (PubChem CID 174902688) has the molecular formula C6H8I5NPb
and a molecular weight of 935.86 g/mol. Its IUPAC name is 1-methylpyridin-1-ium;tetraiodoplumbane;iodide.
Molecular Properties
| Compound Name | 1-methylpyridin-1-ium;tetraiodoplumbane;iodide |
| PubChem CID | 174902688 |
| Molecular Formula | C6H8I5NPb |
| Molecular Weight | 935.86 g/mol |
| Exact Mass | 936.56 |
| IUPAC Name | 1-methylpyridin-1-ium;tetraiodoplumbane;iodide |
| SMILES | C[n+]1ccccc1.I[Pb](I)(I)I.[I-] |
| InChI | InChI=1S/C6H8N.5HI.Pb/c1-7-5-3-2-4-6-7;;;;;;/h2-6H,1H3;5*1H;/q+1;;;;;;+4/p-5 |
| InChIKey | XAKVPDAERBVHHC-UHFFFAOYSA-I |
| XLogP | 0.68 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 935.86 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyridin-1-ium;tetraiodoplumbane;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyridin-1-ium;tetraiodoplumbane;iodide?
The IUPAC name of 1-methylpyridin-1-ium;tetraiodoplumbane;iodide (CID 174902688) is 1-methylpyridin-1-ium;tetraiodoplumbane;iodide.
What is the SMILES notation for 1-methylpyridin-1-ium;tetraiodoplumbane;iodide?
The canonical SMILES for 1-methylpyridin-1-ium;tetraiodoplumbane;iodide is C[n+]1ccccc1.I[Pb](I)(I)I.[I-].
What is the InChIKey of 1-methylpyridin-1-ium;tetraiodoplumbane;iodide?
The InChIKey is XAKVPDAERBVHHC-UHFFFAOYSA-I. The full InChI is InChI=1S/C6H8N.5HI.Pb/c1-7-5-3-2-4-6-7;;;;;;/h2-6H,1H3;5*1H;/q+1;;;;;;+4/p-5.
What are the key properties of 1-methylpyridin-1-ium;tetraiodoplumbane;iodide?
1-methylpyridin-1-ium;tetraiodoplumbane;iodide has a molecular weight of 935.86 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyridin-1-ium;tetraiodoplumbane;iodide is sourced from PubChem (CID 174902688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).