About ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride
ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride (PubChem CID 157199649) has the molecular formula C17H33ClNP
and a molecular weight of 317.88 g/mol. Its IUPAC name is ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride.
Molecular Properties
| Compound Name | ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride |
| PubChem CID | 157199649 |
| Molecular Formula | C17H33ClNP |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride |
| SMILES | CC(C)P(C(C)(C)C)C(C)(C)C.C[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C11H25P.C6H8N.ClH/c1-9(2)12(10(3,4)5)11(6,7)8;1-7-5-3-2-4-6-7;/h9H,1-8H3;2-6H,1H3;1H/q;+1;/p-1 |
| InChIKey | GSGFAGXRWADOGU-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride?
The IUPAC name of ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride (CID 157199649) is ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride.
What is the SMILES notation for ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride?
The canonical SMILES for ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride is CC(C)P(C(C)(C)C)C(C)(C)C.C[n+]1ccccc1.[Cl-].
What is the InChIKey of ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride?
The InChIKey is GSGFAGXRWADOGU-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H25P.C6H8N.ClH/c1-9(2)12(10(3,4)5)11(6,7)8;1-7-5-3-2-4-6-7;/h9H,1-8H3;2-6H,1H3;1H/q;+1;/p-1.
What are the key properties of ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride?
ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride has a molecular weight of 317.88 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(propan-2-yl)phosphane;1-methylpyridin-1-ium;chloride is sourced from PubChem (CID 157199649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).