C24H28N4O2S — CID 175564473
(2S)-N-[(1S)-2-[4-[4-(azetidin-1-ylsulfanyl)phenyl]phenyl]-1-cyanoethyl]-1,4-oxazepane-2-carboxamide (PubChem CID 175564473) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-[4-[4-(azetidin-1-ylsulfanyl)phenyl]phenyl]-1-cyanoethyl]-1,4-oxazepane-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-2-[4-[4-(azetidin-1-ylsulfanyl)phenyl]phenyl]-1-cyanoethyl]-1,4-oxazepane-2-carboxamide |
|---|---|
| PubChem CID | 175564473 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2S)-N-[(1S)-2-[4-[4-(azetidin-1-ylsulfanyl)phenyl]phenyl]-1-cyanoethyl]-1,4-oxazepane-2-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(-c2ccc(SN3CCC3)cc2)cc1)NC(=O)[C@@H]1CNCCCO1 |
| InChI | InChI=1S/C24H28N4O2S/c25-16-21(27-24(29)23-17-26-11-1-14-30-23)15-18-3-5-19(6-4-18)20-7-9-22(10-8-20)31-28-12-2-13-28/h3-10,21,23,26H,1-2,11-15,17H2,(H,27,29)/t21-,23-/m0/s1 |
| InChIKey | OMOOSQGYVYPLHN-GMAHTHKFSA-N |
| XLogP | 3.00 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|