C21H30BN3O4 — CID 177200778
(2S)-N-[(1S)-1-cyano-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,4-oxazepane-2-carboxamide (PubChem CID 177200778) has the molecular formula C21H30BN3O4 and a molecular weight of 399.30 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-cyano-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,4-oxazepane-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-1-cyano-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,4-oxazepane-2-carboxamide |
|---|---|
| PubChem CID | 177200778 |
| Molecular Formula | C21H30BN3O4 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (2S)-N-[(1S)-1-cyano-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,4-oxazepane-2-carboxamide |
| SMILES | CC1(C)OB(c2ccc(C[C@@H](C#N)NC(=O)[C@@H]3CNCCCO3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H30BN3O4/c1-20(2)21(3,4)29-22(28-20)16-8-6-15(7-9-16)12-17(13-23)25-19(26)18-14-24-10-5-11-27-18/h6-9,17-18,24H,5,10-12,14H2,1-4H3,(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | ODNTWQICRMDMFC-ROUUACIJSA-N |
| XLogP | 0.92 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|