About [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane
[(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane (PubChem CID 175565724) has the molecular formula C6H18N4O7S
and a molecular weight of 290.30 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane.
Molecular Properties
| Compound Name | [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane |
| PubChem CID | 175565724 |
| Molecular Formula | C6H18N4O7S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane |
| SMILES | N.N.N[C@@H](CO)C(=O)OS(=O)OC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C6H12N2O7S.2H3N/c7-3(1-9)5(11)14-16(13)15-6(12)4(8)2-10;;/h3-4,9-10H,1-2,7-8H2;2*1H3/t3-,4-;;/m0../s1 |
| InChIKey | IKGWSRFIQPTRAF-RGVONZFCSA-N |
| XLogP | -3.39 |
| TPSA | 232.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane?
The IUPAC name of [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane (CID 175565724) is [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane.
What is the SMILES notation for [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane?
The canonical SMILES for [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane is N.N.N[C@@H](CO)C(=O)OS(=O)OC(=O)[C@@H](N)CO.
What is the InChIKey of [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane?
The InChIKey is IKGWSRFIQPTRAF-RGVONZFCSA-N. The full InChI is InChI=1S/C6H12N2O7S.2H3N/c7-3(1-9)5(11)14-16(13)15-6(12)4(8)2-10;;/h3-4,9-10H,1-2,7-8H2;2*1H3/t3-,4-;;/m0../s1.
What are the key properties of [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane?
[(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane has a molecular weight of 290.30 g/mol, XLogP of -3.39, 6 rotatable bonds, 6 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-amino-3-hydroxypropanoyl]oxysulfinyl (2S)-2-amino-3-hydroxypropanoate;azane is sourced from PubChem (CID 175565724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).