C28H32F8N6O2 — CID 175566211
N-[(S)-(4,4-difluorocyclohexyl)-[6-[(1R)-1-(2,3,4-trifluorobutanoylamino)ethyl]-1H-benzimidazol-2-yl]methyl]-1-methyl-5-(2,3,3-trifluoropropyl)pyrazole-4-carboxamide (PubChem CID 175566211) has the molecular formula C28H32F8N6O2 and a molecular weight of 636.59 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[6-[(1R)-1-(2,3,4-trifluorobutanoylamino)ethyl]-1H-benzimidazol-2-yl]methyl]-1-methyl-5-(2,3,3-trifluoropropyl)pyrazole-4-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[6-[(1R)-1-(2,3,4-trifluorobutanoylamino)ethyl]-1H-benzimidazol-2-yl]methyl]-1-methyl-5-(2,3,3-trifluoropropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175566211 |
| Molecular Formula | C28H32F8N6O2 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[6-[(1R)-1-(2,3,4-trifluorobutanoylamino)ethyl]-1H-benzimidazol-2-yl]methyl]-1-methyl-5-(2,3,3-trifluoropropyl)pyrazole-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C(F)C(F)CF)c1ccc2nc([C@@H](NC(=O)c3cnn(C)c3CC(F)C(F)F)C3CCC(F)(F)CC3)[nH]c2c1 |
| InChI | InChI=1S/C28H32F8N6O2/c1-13(38-27(44)22(32)18(31)11-29)15-3-4-19-20(9-15)40-25(39-19)23(14-5-7-28(35,36)8-6-14)41-26(43)16-12-37-42(2)21(16)10-17(30)24(33)34/h3-4,9,12-14,17-18,22-24H,5-8,10-11H2,1-2H3,(H,38,44)(H,39,40)(H,41,43)/t13-,17?,18?,22?,23+/m1/s1 |
| InChIKey | UDQJKPUDKOXBMK-JZPCFAPESA-N |
| XLogP | 5.56 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |