C20H30F2N4OS — CID 175566217
[[(S)-[6-[(1R)-1-aminoethyl]-1H-benzimidazol-2-yl]-(4,4-difluorocyclohexyl)methyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175566217) has the molecular formula C20H30F2N4OS and a molecular weight of 412.55 g/mol. Its IUPAC name is [[(S)-[6-[(1R)-1-aminoethyl]-1H-benzimidazol-2-yl]-(4,4-difluorocyclohexyl)methyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(S)-[6-[(1R)-1-aminoethyl]-1H-benzimidazol-2-yl]-(4,4-difluorocyclohexyl)methyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175566217 |
| Molecular Formula | C20H30F2N4OS |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [[(S)-[6-[(1R)-1-aminoethyl]-1H-benzimidazol-2-yl]-(4,4-difluorocyclohexyl)methyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C[C@@H](N)c1ccc2nc([C@@H](N[S+]([O-])C(C)(C)C)C3CCC(F)(F)CC3)[nH]c2c1 |
| InChI | InChI=1S/C20H30F2N4OS/c1-12(23)14-5-6-15-16(11-14)25-18(24-15)17(26-28(27)19(2,3)4)13-7-9-20(21,22)10-8-13/h5-6,11-13,17,26H,7-10,23H2,1-4H3,(H,24,25)/t12-,17+,28?/m1/s1 |
| InChIKey | ZEGRLYLXQKAUFP-ZDTSDPLLSA-N |
| XLogP | 4.50 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|