C21H18F3N5O4 — CID 175573561
2,6-dimethoxy-4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)benzimidazol-1-yl]-N-(1,2,2-trifluoroethyl)benzamide (PubChem CID 175573561) has the molecular formula C21H18F3N5O4 and a molecular weight of 461.40 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)benzimidazol-1-yl]-N-(1,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,6-dimethoxy-4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)benzimidazol-1-yl]-N-(1,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 175573561 |
| Molecular Formula | C21H18F3N5O4 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2,6-dimethoxy-4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)benzimidazol-1-yl]-N-(1,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(-n2cnc3cc(-c4noc(C)n4)ccc32)cc(OC)c1C(=O)NC(F)C(F)F |
| InChI | InChI=1S/C21H18F3N5O4/c1-10-26-20(28-33-10)11-4-5-14-13(6-11)25-9-29(14)12-7-15(31-2)17(16(8-12)32-3)21(30)27-19(24)18(22)23/h4-9,18-19H,1-3H3,(H,27,30) |
| InChIKey | KZYVGYJUWOHXEB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|