C23H26F3N5O5 — CID 154636333
tert-butyl N-[[1-[3,5-dimethoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]benzimidazol-5-yl]amino]carbamate (PubChem CID 154636333) has the molecular formula C23H26F3N5O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is tert-butyl N-[[1-[3,5-dimethoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]benzimidazol-5-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[1-[3,5-dimethoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]benzimidazol-5-yl]amino]carbamate |
|---|---|
| PubChem CID | 154636333 |
| Molecular Formula | C23H26F3N5O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | tert-butyl N-[[1-[3,5-dimethoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]benzimidazol-5-yl]amino]carbamate |
| SMILES | COc1cc(-n2cnc3cc(NNC(=O)OC(C)(C)C)ccc32)cc(OC)c1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H26F3N5O5/c1-22(2,3)36-21(33)30-29-13-6-7-16-15(8-13)28-12-31(16)14-9-17(34-4)19(18(10-14)35-5)20(32)27-11-23(24,25)26/h6-10,12,29H,11H2,1-5H3,(H,27,32)(H,30,33) |
| InChIKey | RSGITMIWEDXFLL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|