About 1-chloro-2-ethenyl-4,5-difluorobenzene
1-chloro-2-ethenyl-4,5-difluorobenzene (PubChem CID 175575459) has the molecular formula C8H5ClF2
and a molecular weight of 174.58 g/mol. Its IUPAC name is 1-chloro-2-ethenyl-4,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-chloro-2-ethenyl-4,5-difluorobenzene |
| PubChem CID | 175575459 |
| Molecular Formula | C8H5ClF2 |
| Molecular Weight | 174.58 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 1-chloro-2-ethenyl-4,5-difluorobenzene |
| SMILES | C=Cc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C8H5ClF2/c1-2-5-3-7(10)8(11)4-6(5)9/h2-4H,1H2 |
| InChIKey | NYGYJVGGEXYTRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-ethenyl-4,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethenyl-4,5-difluorobenzene?
The IUPAC name of 1-chloro-2-ethenyl-4,5-difluorobenzene (CID 175575459) is 1-chloro-2-ethenyl-4,5-difluorobenzene.
What is the SMILES notation for 1-chloro-2-ethenyl-4,5-difluorobenzene?
The canonical SMILES for 1-chloro-2-ethenyl-4,5-difluorobenzene is C=Cc1cc(F)c(F)cc1Cl.
What is the InChIKey of 1-chloro-2-ethenyl-4,5-difluorobenzene?
The InChIKey is NYGYJVGGEXYTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2/c1-2-5-3-7(10)8(11)4-6(5)9/h2-4H,1H2.
What are the key properties of 1-chloro-2-ethenyl-4,5-difluorobenzene?
1-chloro-2-ethenyl-4,5-difluorobenzene has a molecular weight of 174.58 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethenyl-4,5-difluorobenzene is sourced from PubChem (CID 175575459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).