C10H17F3N2O3 — CID 175576585
tert-butyl N-[3-oxo-3-(1,2,2-trifluoroethylamino)propyl]carbamate (PubChem CID 175576585) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-(1,2,2-trifluoroethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-(1,2,2-trifluoroethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 175576585 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | tert-butyl N-[3-oxo-3-(1,2,2-trifluoroethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC(F)C(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-10(2,3)18-9(17)14-5-4-6(16)15-8(13)7(11)12/h7-8H,4-5H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | HEYBAGNOWPLHKK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|