About 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate
3-hydroxypropylsulfonyl (Z)-octadec-9-enoate (PubChem CID 175577720) has the molecular formula C21H40O5S
and a molecular weight of 404.61 g/mol. Its IUPAC name is 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate |
| PubChem CID | 175577720 |
| Molecular Formula | C21H40O5S |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OS(=O)(=O)CCCO |
| InChI | InChI=1S/C21H40O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)26-27(24,25)20-17-19-22/h9-10,22H,2-8,11-20H2,1H3/b10-9- |
| InChIKey | RDKOUALFLBZCSJ-KTKRTIGZSA-N |
| XLogP | 5.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate?
The IUPAC name of 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate (CID 175577720) is 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate.
What is the SMILES notation for 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate?
The canonical SMILES for 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OS(=O)(=O)CCCO.
What is the InChIKey of 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate?
The InChIKey is RDKOUALFLBZCSJ-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H40O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)26-27(24,25)20-17-19-22/h9-10,22H,2-8,11-20H2,1H3/b10-9-.
What are the key properties of 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate?
3-hydroxypropylsulfonyl (Z)-octadec-9-enoate has a molecular weight of 404.61 g/mol, XLogP of 5.28, 19 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropylsulfonyl (Z)-octadec-9-enoate is sourced from PubChem (CID 175577720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).