About potassium;hydride;2-hydroxyethylsulfonyl decanoate
potassium;hydride;2-hydroxyethylsulfonyl decanoate (PubChem CID 173291216) has the molecular formula C12H25KO5S
and a molecular weight of 320.49 g/mol. Its IUPAC name is potassium;hydride;2-hydroxyethylsulfonyl decanoate.
Molecular Properties
| Compound Name | potassium;hydride;2-hydroxyethylsulfonyl decanoate |
| PubChem CID | 173291216 |
| Molecular Formula | C12H25KO5S |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | potassium;hydride;2-hydroxyethylsulfonyl decanoate |
| SMILES | CCCCCCCCCC(=O)OS(=O)(=O)CCO.[H-].[K+] |
| InChI | InChI=1S/C12H24O5S.K.H/c1-2-3-4-5-6-7-8-9-12(14)17-18(15,16)11-10-13;;/h13H,2-11H2,1H3;;/q;+1;-1 |
| InChIKey | KHSCYAIXZLAAIW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;2-hydroxyethylsulfonyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-hydroxyethylsulfonyl decanoate?
The IUPAC name of potassium;hydride;2-hydroxyethylsulfonyl decanoate (CID 173291216) is potassium;hydride;2-hydroxyethylsulfonyl decanoate.
What is the SMILES notation for potassium;hydride;2-hydroxyethylsulfonyl decanoate?
The canonical SMILES for potassium;hydride;2-hydroxyethylsulfonyl decanoate is CCCCCCCCCC(=O)OS(=O)(=O)CCO.[H-].[K+].
What is the InChIKey of potassium;hydride;2-hydroxyethylsulfonyl decanoate?
The InChIKey is KHSCYAIXZLAAIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O5S.K.H/c1-2-3-4-5-6-7-8-9-12(14)17-18(15,16)11-10-13;;/h13H,2-11H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;2-hydroxyethylsulfonyl decanoate?
potassium;hydride;2-hydroxyethylsulfonyl decanoate has a molecular weight of 320.49 g/mol, XLogP of -0.89, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-hydroxyethylsulfonyl decanoate is sourced from PubChem (CID 173291216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).