C11H9I2NO3 — CID 175577854
(2,5-diiodophenyl)carbamoyl 2-methylprop-2-enoate (PubChem CID 175577854) has the molecular formula C11H9I2NO3 and a molecular weight of 457.01 g/mol. Its IUPAC name is (2,5-diiodophenyl)carbamoyl 2-methylprop-2-enoate.
| Compound Name | (2,5-diiodophenyl)carbamoyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175577854 |
| Molecular Formula | C11H9I2NO3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.87 |
| IUPAC Name | (2,5-diiodophenyl)carbamoyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)Nc1cc(I)ccc1I |
| InChI | InChI=1S/C11H9I2NO3/c1-6(2)10(15)17-11(16)14-9-5-7(12)3-4-8(9)13/h3-5H,1H2,2H3,(H,14,16) |
| InChIKey | PBNCCHGKTIUAFJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|