C38H39F2N5O2 — CID 175580591
tert-butyl (2S)-4-[5-(2,2-difluoroethenyl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 175580591) has the molecular formula C38H39F2N5O2 and a molecular weight of 635.76 g/mol. Its IUPAC name is tert-butyl (2S)-4-[5-(2,2-difluoroethenyl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[5-(2,2-difluoroethenyl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175580591 |
| Molecular Formula | C38H39F2N5O2 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | tert-butyl (2S)-4-[5-(2,2-difluoroethenyl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1c1ncnc2c1c(C=C(F)F)cn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H39F2N5O2/c1-26-23-44(36(46)47-37(3,4)5)27(2)22-43(26)34-33-28(21-32(39)40)24-45(35(33)42-25-41-34)38(29-15-9-6-10-16-29,30-17-11-7-12-18-30)31-19-13-8-14-20-31/h6-21,24-27H,22-23H2,1-5H3/t26?,27-/m0/s1 |
| InChIKey | WNDOIJQBARNECU-GEVKEYJPSA-N |
| XLogP | 8.34 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|