C32H34ClN5O2 — CID 177369107
tert-butyl (2R,5S)-4-[5-(benzhydrylideneamino)-8-chloroquinazolin-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 177369107) has the molecular formula C32H34ClN5O2 and a molecular weight of 556.11 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[5-(benzhydrylideneamino)-8-chloroquinazolin-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[5-(benzhydrylideneamino)-8-chloroquinazolin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177369107 |
| Molecular Formula | C32H34ClN5O2 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | tert-butyl (2R,5S)-4-[5-(benzhydrylideneamino)-8-chloroquinazolin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ncnc3c(Cl)ccc(N=C(c4ccccc4)c4ccccc4)c23)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H34ClN5O2/c1-21-19-38(31(39)40-32(3,4)5)22(2)18-37(21)30-27-26(17-16-25(33)29(27)34-20-35-30)36-28(23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-17,20-22H,18-19H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | HIRCJQPYEDGTFD-FCHUYYIVSA-N |
| XLogP | 7.29 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|