C21H24BrN7O4 — CID 175580816
tert-butyl 4-[3-bromo-1-(3-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 175580816) has the molecular formula C21H24BrN7O4 and a molecular weight of 518.37 g/mol. Its IUPAC name is tert-butyl 4-[3-bromo-1-(3-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-bromo-1-(3-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175580816 |
| Molecular Formula | C21H24BrN7O4 |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | tert-butyl 4-[3-bromo-1-(3-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1ncnc2c1c(Br)nn2-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24BrN7O4/c1-13-11-26(20(30)33-21(2,3)4)8-9-27(13)18-16-17(22)25-28(19(16)24-12-23-18)14-6-5-7-15(10-14)29(31)32/h5-7,10,12-13H,8-9,11H2,1-4H3 |
| InChIKey | ZVASDBSNIXPZQT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|