C21H21FN4O3S — CID 175582373
5-[6-amino-5-fluoro-2-(4-methylsulfonylphenyl)pyrimidin-4-yl]-1-cyclopentylpyridin-2-one (PubChem CID 175582373) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is 5-[6-amino-5-fluoro-2-(4-methylsulfonylphenyl)pyrimidin-4-yl]-1-cyclopentylpyridin-2-one.
| Compound Name | 5-[6-amino-5-fluoro-2-(4-methylsulfonylphenyl)pyrimidin-4-yl]-1-cyclopentylpyridin-2-one |
|---|---|
| PubChem CID | 175582373 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 5-[6-amino-5-fluoro-2-(4-methylsulfonylphenyl)pyrimidin-4-yl]-1-cyclopentylpyridin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(N)c(F)c(-c3ccc(=O)n(C4CCCC4)c3)n2)cc1 |
| InChI | InChI=1S/C21H21FN4O3S/c1-30(28,29)16-9-6-13(7-10-16)21-24-19(18(22)20(23)25-21)14-8-11-17(27)26(12-14)15-4-2-3-5-15/h6-12,15H,2-5H2,1H3,(H2,23,24,25) |
| InChIKey | QXSPJJFKULUKKP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |