C20H13ClF4N4O4 — CID 175582849
N-[1-[2-chloro-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-1-(2-fluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 175582849) has the molecular formula C20H13ClF4N4O4 and a molecular weight of 484.79 g/mol. Its IUPAC name is N-[1-[2-chloro-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-1-(2-fluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[1-[2-chloro-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-1-(2-fluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175582849 |
| Molecular Formula | C20H13ClF4N4O4 |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-[1-[2-chloro-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-1-(2-fluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(=O)n(-c2ccccc2F)n1)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C20H13ClF4N4O4/c1-10(12-8-11(29(32)33)9-13(18(12)21)20(23,24)25)26-19(31)15-6-7-17(30)28(27-15)16-5-3-2-4-14(16)22/h2-10H,1H3,(H,26,31) |
| InChIKey | ZGSBMPHRBFNMGN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|