C21H16F4N4O4 — CID 172536168
1-(2-fluorophenyl)-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-6-oxopyridazine-3-carboxamide (PubChem CID 172536168) has the molecular formula C21H16F4N4O4 and a molecular weight of 464.38 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 172536168 |
| Molecular Formula | C21H16F4N4O4 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(1R)-1-[2-methyl-5-nitro-3-(trifluoromethyl)phenyl]ethyl]-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1c([C@@H](C)NC(=O)c2ccc(=O)n(-c3ccccc3F)n2)cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C21H16F4N4O4/c1-11-14(9-13(29(32)33)10-15(11)21(23,24)25)12(2)26-20(31)17-7-8-19(30)28(27-17)18-6-4-3-5-16(18)22/h3-10,12H,1-2H3,(H,26,31)/t12-/m1/s1 |
| InChIKey | XHCUQJFJVUXMCZ-GFCCVEGCSA-N |
| XLogP | 4.10 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|