C11H11F3O — CID 175584794
1-cyclopropyloxy-2-[(1R)-1,2,2-trifluoroethyl]benzene (PubChem CID 175584794) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 1-cyclopropyloxy-2-[(1R)-1,2,2-trifluoroethyl]benzene.
| Compound Name | 1-cyclopropyloxy-2-[(1R)-1,2,2-trifluoroethyl]benzene |
|---|---|
| PubChem CID | 175584794 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-cyclopropyloxy-2-[(1R)-1,2,2-trifluoroethyl]benzene |
| SMILES | FC(F)[C@H](F)c1ccccc1OC1CC1 |
| InChI | InChI=1S/C11H11F3O/c12-10(11(13)14)8-3-1-2-4-9(8)15-7-5-6-7/h1-4,7,10-11H,5-6H2/t10-/m1/s1 |
| InChIKey | HZGYAALYKCOHDU-SNVBAGLBSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |