C12H18ClN5OS — CID 175585975
1-(5-chloro-2-oxo-1H-pyrazin-3-yl)-3-(1-ethylpiperidin-3-yl)thiourea (PubChem CID 175585975) has the molecular formula C12H18ClN5OS and a molecular weight of 315.83 g/mol. Its IUPAC name is 1-(5-chloro-2-oxo-1H-pyrazin-3-yl)-3-(1-ethylpiperidin-3-yl)thiourea.
| Compound Name | 1-(5-chloro-2-oxo-1H-pyrazin-3-yl)-3-(1-ethylpiperidin-3-yl)thiourea |
|---|---|
| PubChem CID | 175585975 |
| Molecular Formula | C12H18ClN5OS |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(5-chloro-2-oxo-1H-pyrazin-3-yl)-3-(1-ethylpiperidin-3-yl)thiourea |
| SMILES | CCN1CCCC(NC(=S)Nc2nc(Cl)c[nH]c2=O)C1 |
| InChI | InChI=1S/C12H18ClN5OS/c1-2-18-5-3-4-8(7-18)15-12(20)17-10-11(19)14-6-9(13)16-10/h6,8H,2-5,7H2,1H3,(H,14,19)(H2,15,16,17,20) |
| InChIKey | BLFPLGFDJROZMM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|