C20H24F3N5O2S — CID 170156928
1-(1-ethylpiperidin-3-yl)-3-[5-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-2-oxo-1H-pyrazin-3-yl]thiourea (PubChem CID 170156928) has the molecular formula C20H24F3N5O2S and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-3-[5-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-2-oxo-1H-pyrazin-3-yl]thiourea.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-3-[5-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-2-oxo-1H-pyrazin-3-yl]thiourea |
|---|---|
| PubChem CID | 170156928 |
| Molecular Formula | C20H24F3N5O2S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-3-[5-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-2-oxo-1H-pyrazin-3-yl]thiourea |
| SMILES | CCN1CCCC(NC(=S)Nc2nc(-c3c(C)cc(C(F)(F)F)cc3O)c[nH]c2=O)C1 |
| InChI | InChI=1S/C20H24F3N5O2S/c1-3-28-6-4-5-13(10-28)25-19(31)27-17-18(30)24-9-14(26-17)16-11(2)7-12(8-15(16)29)20(21,22)23/h7-9,13,29H,3-6,10H2,1-2H3,(H,24,30)(H2,25,26,27,31) |
| InChIKey | NYQYCVCLHMVBRC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|