C31H37N3O7S — CID 175590611
benzyl N-[2-[2-[(3S)-3-[(3-methyl-4-phenylmethoxyphenyl)methylsulfonylamino]-2-oxopyrrolidin-1-yl]ethoxy]ethyl]carbamate (PubChem CID 175590611) has the molecular formula C31H37N3O7S and a molecular weight of 595.72 g/mol. Its IUPAC name is benzyl N-[2-[2-[(3S)-3-[(3-methyl-4-phenylmethoxyphenyl)methylsulfonylamino]-2-oxopyrrolidin-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[(3S)-3-[(3-methyl-4-phenylmethoxyphenyl)methylsulfonylamino]-2-oxopyrrolidin-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 175590611 |
| Molecular Formula | C31H37N3O7S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | benzyl N-[2-[2-[(3S)-3-[(3-methyl-4-phenylmethoxyphenyl)methylsulfonylamino]-2-oxopyrrolidin-1-yl]ethoxy]ethyl]carbamate |
| SMILES | Cc1cc(CS(=O)(=O)N[C@H]2CCN(CCOCCNC(=O)OCc3ccccc3)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H37N3O7S/c1-24-20-27(12-13-29(24)40-21-25-8-4-2-5-9-25)23-42(37,38)33-28-14-16-34(30(28)35)17-19-39-18-15-32-31(36)41-22-26-10-6-3-7-11-26/h2-13,20,28,33H,14-19,21-23H2,1H3,(H,32,36)/t28-/m0/s1 |
| InChIKey | LACBIEWGCHYZQK-NDEPHWFRSA-N |
| XLogP | 3.54 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|