C14H17F3N2O — CID 175590912
8-methoxy-5-(1,2,2-trifluoroethyl)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline (PubChem CID 175590912) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 8-methoxy-5-(1,2,2-trifluoroethyl)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline.
| Compound Name | 8-methoxy-5-(1,2,2-trifluoroethyl)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 175590912 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 8-methoxy-5-(1,2,2-trifluoroethyl)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline |
| SMILES | COc1ccc2c(c1)N1CCCC1CN2C(F)C(F)F |
| InChI | InChI=1S/C14H17F3N2O/c1-20-10-4-5-11-12(7-10)18-6-2-3-9(18)8-19(11)14(17)13(15)16/h4-5,7,9,13-14H,2-3,6,8H2,1H3 |
| InChIKey | VPRRQTPBXQXJOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|