C16H22N2O3 — CID 156781351
methyl 3-(8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate (PubChem CID 156781351) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 3-(8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate.
| Compound Name | methyl 3-(8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate |
|---|---|
| PubChem CID | 156781351 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl 3-(8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate |
| SMILES | COC(=O)CCN1CC2CCCN2c2cc(OC)ccc21 |
| InChI | InChI=1S/C16H22N2O3/c1-20-13-5-6-14-15(10-13)18-8-3-4-12(18)11-17(14)9-7-16(19)21-2/h5-6,10,12H,3-4,7-9,11H2,1-2H3 |
| InChIKey | VDSZUNFLABSMML-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|