C17H22N2O4 — CID 176656280
methyl 3-(7-formyl-8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate (PubChem CID 176656280) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 3-(7-formyl-8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate.
| Compound Name | methyl 3-(7-formyl-8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate |
|---|---|
| PubChem CID | 176656280 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 3-(7-formyl-8-methoxy-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl)propanoate |
| SMILES | COC(=O)CCN1CC2CCCN2c2cc(OC)c(C=O)cc21 |
| InChI | InChI=1S/C17H22N2O4/c1-22-16-9-15-14(8-12(16)11-20)18(7-5-17(21)23-2)10-13-4-3-6-19(13)15/h8-9,11,13H,3-7,10H2,1-2H3 |
| InChIKey | KDUZYXWUVVKJQP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|