C25H31N3O5 — CID 92707721
4-[(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl]-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide (PubChem CID 92707721) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl]-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide.
| Compound Name | 4-[(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl]-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 92707721 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-5-yl]-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
| SMILES | COc1cc(CNC(=O)CCC(=O)N2C[C@@H]3CCCN3c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C25H31N3O5/c1-31-21-13-17(14-22(32-2)25(21)33-3)15-26-23(29)10-11-24(30)28-16-18-7-6-12-27(18)19-8-4-5-9-20(19)28/h4-5,8-9,13-14,18H,6-7,10-12,15-16H2,1-3H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | ALZGZWPTPNQRTO-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |