C25H22F3N7O4 — CID 175592546
4-[4-amino-6-[2-methoxy-4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide (PubChem CID 175592546) has the molecular formula C25H22F3N7O4 and a molecular weight of 541.49 g/mol. Its IUPAC name is 4-[4-amino-6-[2-methoxy-4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-amino-6-[2-methoxy-4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 175592546 |
| Molecular Formula | C25H22F3N7O4 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 4-[4-amino-6-[2-methoxy-4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide |
| SMILES | C=CC(=O)Nc1ccc(-c2nn3ncnc(N)c3c2-c2ccc(C(=O)NC(F)C(F)F)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C25H22F3N7O4/c1-4-18(36)32-13-6-8-14(17(10-13)39-3)20-19(21-24(29)30-11-31-35(21)34-20)12-5-7-15(16(9-12)38-2)25(37)33-23(28)22(26)27/h4-11,22-23H,1H2,2-3H3,(H,32,36)(H,33,37)(H2,29,30,31) |
| InChIKey | BKFQQDOPDKLPAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|