C24H22FN7O3 — CID 171617828
4-[4-amino-6-[4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-N-(2-fluoroethyl)-2-methoxybenzamide (PubChem CID 171617828) has the molecular formula C24H22FN7O3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 4-[4-amino-6-[4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-N-(2-fluoroethyl)-2-methoxybenzamide.
| Compound Name | 4-[4-amino-6-[4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-N-(2-fluoroethyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 171617828 |
| Molecular Formula | C24H22FN7O3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[4-amino-6-[4-(prop-2-enoylamino)phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-N-(2-fluoroethyl)-2-methoxybenzamide |
| SMILES | C=CC(=O)Nc1ccc(-c2nn3ncnc(N)c3c2-c2ccc(C(=O)NCCF)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H22FN7O3/c1-3-19(33)30-16-7-4-14(5-8-16)21-20(22-23(26)28-13-29-32(22)31-21)15-6-9-17(18(12-15)35-2)24(34)27-11-10-25/h3-9,12-13H,1,10-11H2,2H3,(H,27,34)(H,30,33)(H2,26,28,29) |
| InChIKey | GYGJSUNPQZTNGF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|