C23H18F4N8O3 — CID 171617522
4-[4-amino-6-[6-(2-fluoroprop-2-enoylamino)-3-pyridinyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 171617522) has the molecular formula C23H18F4N8O3 and a molecular weight of 530.44 g/mol. Its IUPAC name is 4-[4-amino-6-[6-(2-fluoroprop-2-enoylamino)-3-pyridinyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-amino-6-[6-(2-fluoroprop-2-enoylamino)-3-pyridinyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 171617522 |
| Molecular Formula | C23H18F4N8O3 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 4-[4-amino-6-[6-(2-fluoroprop-2-enoylamino)-3-pyridinyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C=C(F)C(=O)Nc1ccc(-c2nn3ncnc(N)c3c2-c2ccc(C(=O)NCC(F)(F)F)c(OC)c2)cn1 |
| InChI | InChI=1S/C23H18F4N8O3/c1-11(24)21(36)33-16-6-4-13(8-29-16)18-17(19-20(28)31-10-32-35(19)34-18)12-3-5-14(15(7-12)38-2)22(37)30-9-23(25,26)27/h3-8,10H,1,9H2,2H3,(H,30,37)(H2,28,31,32)(H,29,33,36) |
| InChIKey | OFDQVOJSWOBKOV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|