C26H23F4N7O2 — CID 171617785
N-[4-[4-amino-5-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]-3-methoxyphenyl]pyrazolo[5,1-f][1,2,4]triazin-6-yl]phenyl]-2-fluoroprop-2-enamide (PubChem CID 171617785) has the molecular formula C26H23F4N7O2 and a molecular weight of 541.51 g/mol. Its IUPAC name is N-[4-[4-amino-5-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]-3-methoxyphenyl]pyrazolo[5,1-f][1,2,4]triazin-6-yl]phenyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[4-[4-amino-5-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]-3-methoxyphenyl]pyrazolo[5,1-f][1,2,4]triazin-6-yl]phenyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 171617785 |
| Molecular Formula | C26H23F4N7O2 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-[4-[4-amino-5-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]-3-methoxyphenyl]pyrazolo[5,1-f][1,2,4]triazin-6-yl]phenyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1ccc(-c2nn3ncnc(N)c3c2-c2ccc(C(NC3CC3)C(F)(F)F)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H23F4N7O2/c1-13(27)25(38)35-17-6-3-14(4-7-17)21-20(22-24(31)32-12-33-37(22)36-21)15-5-10-18(19(11-15)39-2)23(26(28,29)30)34-16-8-9-16/h3-7,10-12,16,23,34H,1,8-9H2,2H3,(H,35,38)(H2,31,32,33) |
| InChIKey | BJMVWUUHPCZPSN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|