C17H27NO3Si — CID 175594357
(5S)-1-benzyl-5-(2,2-dimethylpropylsilylperoxymethyl)pyrrolidin-2-one (PubChem CID 175594357) has the molecular formula C17H27NO3Si and a molecular weight of 321.49 g/mol. Its IUPAC name is (5S)-1-benzyl-5-(2,2-dimethylpropylsilylperoxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-benzyl-5-(2,2-dimethylpropylsilylperoxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175594357 |
| Molecular Formula | C17H27NO3Si |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (5S)-1-benzyl-5-(2,2-dimethylpropylsilylperoxymethyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)C[SiH2]OOC[C@@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H27NO3Si/c1-17(2,3)13-22-21-20-12-15-9-10-16(19)18(15)11-14-7-5-4-6-8-14/h4-8,15H,9-13,22H2,1-3H3/t15-/m0/s1 |
| InChIKey | KRBMHOOADJOPOJ-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|