C13H17NO3 — CID 22845684
(5S)-1-benzyl-5-(1,1-dihydroxyethyl)pyrrolidin-2-one (PubChem CID 22845684) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (5S)-1-benzyl-5-(1,1-dihydroxyethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-benzyl-5-(1,1-dihydroxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 22845684 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (5S)-1-benzyl-5-(1,1-dihydroxyethyl)pyrrolidin-2-one |
| SMILES | CC(O)(O)[C@@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-13(16,17)11-7-8-12(15)14(11)9-10-5-3-2-4-6-10/h2-6,11,16-17H,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | KMJDOEMMEJCKHU-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|