C12H20F3N3O3 — CID 175594671
tert-butyl 4-(1,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 175594671) has the molecular formula C12H20F3N3O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is tert-butyl 4-(1,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175594671 |
| Molecular Formula | C12H20F3N3O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | tert-butyl 4-(1,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)NC(F)C(F)F)CC1 |
| InChI | InChI=1S/C12H20F3N3O3/c1-12(2,3)21-11(20)18-6-4-17(5-7-18)10(19)16-9(15)8(13)14/h8-9H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | KBHQCDWGYBAEJH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|