C31H34N2O6 — CID 175596135
benzyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]acetate (PubChem CID 175596135) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is benzyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]acetate.
| Compound Name | benzyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]acetate |
|---|---|
| PubChem CID | 175596135 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | benzyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]acetate |
| SMILES | CCC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCOCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H34N2O6/c1-3-21(2)29(30(35)32-20-37-19-28(34)38-17-22-11-5-4-6-12-22)33-31(36)39-18-27-25-15-9-7-13-23(25)24-14-8-10-16-26(24)27/h4-16,21,27,29H,3,17-20H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | WNKXWNCTVMPHTR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|