C31H34N2O6 — CID 175108731
2-[[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]-3-phenylpropanoic acid (PubChem CID 175108731) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 175108731 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 2-[[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]methoxy]-3-phenylpropanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCOC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H34N2O6/c1-3-20(2)28(29(34)32-19-39-27(30(35)36)17-21-11-5-4-6-12-21)33-31(37)38-18-26-24-15-9-7-13-22(24)23-14-8-10-16-25(23)26/h4-16,20,26-28H,3,17-19H2,1-2H3,(H,32,34)(H,33,37)(H,35,36)/t20-,27?,28-/m0/s1 |
| InChIKey | KUOFGLQNOLDEFI-FKIKWWETSA-N |
| XLogP | 4.73 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|