C27H26N2O6 — CID 122686223
2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoic acid (PubChem CID 122686223) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122686223 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoic acid |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)NCOC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H26N2O6/c30-25(29-17-35-24(26(31)32)14-18-8-2-1-3-9-18)15-28-27(33)34-16-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23-24H,14-17H2,(H,28,33)(H,29,30)(H,31,32) |
| InChIKey | GIXAREXXLDCREW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|