C31H34N2O6 — CID 176639188
butyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoate (PubChem CID 176639188) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is butyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoate.
| Compound Name | butyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 176639188 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | butyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]-3-phenylpropanoate |
| SMILES | CCCCOC(=O)C(Cc1ccccc1)OCNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H34N2O6/c1-2-3-17-37-30(35)28(18-22-11-5-4-6-12-22)39-21-33-29(34)19-32-31(36)38-20-27-25-15-9-7-13-23(25)24-14-8-10-16-26(24)27/h4-16,27-28H,2-3,17-21H2,1H3,(H,32,36)(H,33,34) |
| InChIKey | YLFDPZRWJXDOFN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|