C27H23ClN4O5S2 — CID 175597176
(4-chlorophenyl)-[(2S)-3-(1H-indol-3-yl)-1-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfamic acid (PubChem CID 175597176) has the molecular formula C27H23ClN4O5S2 and a molecular weight of 583.09 g/mol. Its IUPAC name is (4-chlorophenyl)-[(2S)-3-(1H-indol-3-yl)-1-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfamic acid.
| Compound Name | (4-chlorophenyl)-[(2S)-3-(1H-indol-3-yl)-1-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 175597176 |
| Molecular Formula | C27H23ClN4O5S2 |
| Molecular Weight | 583.09 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | (4-chlorophenyl)-[(2S)-3-(1H-indol-3-yl)-1-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfamic acid |
| SMILES | COc1ccc(-c2csc(NC(=O)[C@H](Cc3c[nH]c4ccccc34)N(c3ccc(Cl)cc3)S(=O)(=O)O)n2)cc1 |
| InChI | InChI=1S/C27H23ClN4O5S2/c1-37-21-12-6-17(7-13-21)24-16-38-27(30-24)31-26(33)25(14-18-15-29-23-5-3-2-4-22(18)23)32(39(34,35)36)20-10-8-19(28)9-11-20/h2-13,15-16,25,29H,14H2,1H3,(H,30,31,33)(H,34,35,36)/t25-/m0/s1 |
| InChIKey | JORJZBRLKGDTJA-VWLOTQADSA-N |
| XLogP | 5.81 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|