C22H25F2N5O2 — CID 175599267
1-[2-(difluoromethyl)-4-methylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine;formic acid (PubChem CID 175599267) has the molecular formula C22H25F2N5O2 and a molecular weight of 429.47 g/mol. Its IUPAC name is 1-[2-(difluoromethyl)-4-methylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine;formic acid.
| Compound Name | 1-[2-(difluoromethyl)-4-methylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine;formic acid |
|---|---|
| PubChem CID | 175599267 |
| Molecular Formula | C22H25F2N5O2 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 1-[2-(difluoromethyl)-4-methylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[3,4-d]pyridazin-4-amine;formic acid |
| SMILES | Cc1ccc(-c2nnc(N[C@@H]3CCCN(C)C3)c3cnccc23)c(C(F)F)c1.O=CO |
| InChI | InChI=1S/C21H23F2N5.CH2O2/c1-13-5-6-15(17(10-13)20(22)23)19-16-7-8-24-11-18(16)21(27-26-19)25-14-4-3-9-28(2)12-14;2-1-3/h5-8,10-11,14,20H,3-4,9,12H2,1-2H3,(H,25,27);1H,(H,2,3)/t14-;/m1./s1 |
| InChIKey | NHWLJOHGSDRMPJ-PFEQFJNWSA-N |
| XLogP | 4.14 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|