C22H23F3N6O3 — CID 175599365
formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrido[3,4-d]pyridazin-1-yl]-5-(trifluoromethyl)benzamide (PubChem CID 175599365) has the molecular formula C22H23F3N6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrido[3,4-d]pyridazin-1-yl]-5-(trifluoromethyl)benzamide.
| Compound Name | formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrido[3,4-d]pyridazin-1-yl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175599365 |
| Molecular Formula | C22H23F3N6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | formic acid;2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrido[3,4-d]pyridazin-1-yl]-5-(trifluoromethyl)benzamide |
| SMILES | CN1CCC[C@@H](Nc2nnc(-c3ccc(C(F)(F)F)cc3C(N)=O)c3ccncc23)C1.O=CO |
| InChI | InChI=1S/C21H21F3N6O.CH2O2/c1-30-8-2-3-13(11-30)27-20-17-10-26-7-6-15(17)18(28-29-20)14-5-4-12(21(22,23)24)9-16(14)19(25)31;2-1-3/h4-7,9-10,13H,2-3,8,11H2,1H3,(H2,25,31)(H,27,29);1H,(H,2,3)/t13-;/m1./s1 |
| InChIKey | XTAHUXKBZYNTCU-BTQNPOSSSA-N |
| XLogP | 3.02 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|