C20H15F2N3O4 — CID 175599489
2-(3,5-difluorophenyl)-N-[4-(4-methoxy-2-nitrophenyl)-2-pyridinyl]acetamide (PubChem CID 175599489) has the molecular formula C20H15F2N3O4 and a molecular weight of 399.35 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[4-(4-methoxy-2-nitrophenyl)-2-pyridinyl]acetamide.
| Compound Name | 2-(3,5-difluorophenyl)-N-[4-(4-methoxy-2-nitrophenyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 175599489 |
| Molecular Formula | C20H15F2N3O4 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[4-(4-methoxy-2-nitrophenyl)-2-pyridinyl]acetamide |
| SMILES | COc1ccc(-c2ccnc(NC(=O)Cc3cc(F)cc(F)c3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15F2N3O4/c1-29-16-2-3-17(18(11-16)25(27)28)13-4-5-23-19(9-13)24-20(26)8-12-6-14(21)10-15(22)7-12/h2-7,9-11H,8H2,1H3,(H,23,24,26) |
| InChIKey | MSJDJDDCHQAOKW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|