C23H34Cl2N4O — CID 175603520
1-tert-butyl-3-[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]cyclohex-3-en-1-yl]urea (PubChem CID 175603520) has the molecular formula C23H34Cl2N4O and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]cyclohex-3-en-1-yl]urea.
| Compound Name | 1-tert-butyl-3-[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]cyclohex-3-en-1-yl]urea |
|---|---|
| PubChem CID | 175603520 |
| Molecular Formula | C23H34Cl2N4O |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-tert-butyl-3-[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]cyclohex-3-en-1-yl]urea |
| SMILES | CC(C)(C)NC(=O)NC1CC=C(C(C)(c2cccc(Cl)c2Cl)N2CCNCC2)CC1 |
| InChI | InChI=1S/C23H34Cl2N4O/c1-22(2,3)28-21(30)27-17-10-8-16(9-11-17)23(4,29-14-12-26-13-15-29)18-6-5-7-19(24)20(18)25/h5-8,17,26H,9-15H2,1-4H3,(H2,27,28,30) |
| InChIKey | WOSXQWCAEQBPFO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|