C19H27Cl2FN4O — CID 175603611
[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea (PubChem CID 175603611) has the molecular formula C19H27Cl2FN4O and a molecular weight of 417.36 g/mol. Its IUPAC name is [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea.
| Compound Name | [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea |
|---|---|
| PubChem CID | 175603611 |
| Molecular Formula | C19H27Cl2FN4O |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea |
| SMILES | CC(c1cccc(Cl)c1Cl)(N1CCNCC1)C1(F)CCC(NC(N)=O)CC1 |
| InChI | InChI=1S/C19H27Cl2FN4O/c1-18(26-11-9-24-10-12-26,14-3-2-4-15(20)16(14)21)19(22)7-5-13(6-8-19)25-17(23)27/h2-4,13,24H,5-12H2,1H3,(H3,23,25,27) |
| InChIKey | QBPHJYQUNAPMNE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |