About [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea
[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea (PubChem CID 175603611) has the molecular formula C19H27Cl2FN4O
and a molecular weight of 417.36 g/mol. Its IUPAC name is [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea.
Molecular Properties
| Compound Name | [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea |
| PubChem CID | 175603611 |
| Molecular Formula | C19H27Cl2FN4O |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea |
| SMILES | CC(c1cccc(Cl)c1Cl)(N1CCNCC1)C1(F)CCC(NC(N)=O)CC1 |
| InChI | InChI=1S/C19H27Cl2FN4O/c1-18(26-11-9-24-10-12-26,14-3-2-4-15(20)16(14)21)19(22)7-5-13(6-8-19)25-17(23)27/h2-4,13,24H,5-12H2,1H3,(H3,23,25,27) |
| InChIKey | QBPHJYQUNAPMNE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea?
The IUPAC name of [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea (CID 175603611) is [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea.
What is the SMILES notation for [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea?
The canonical SMILES for [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea is CC(c1cccc(Cl)c1Cl)(N1CCNCC1)C1(F)CCC(NC(N)=O)CC1.
What is the InChIKey of [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea?
The InChIKey is QBPHJYQUNAPMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27Cl2FN4O/c1-18(26-11-9-24-10-12-26,14-3-2-4-15(20)16(14)21)19(22)7-5-13(6-8-19)25-17(23)27/h2-4,13,24H,5-12H2,1H3,(H3,23,25,27).
What are the key properties of [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea?
[4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea has a molecular weight of 417.36 g/mol, XLogP of 3.43, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(2,3-dichlorophenyl)-1-piperazin-1-ylethyl]-4-fluorocyclohexyl]urea is sourced from PubChem (CID 175603611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).